|
CAS#: 53859-19-1 Product: Retinol Phosphate No suppilers available for the product. |
| Name | Retinol Phosphate |
|---|---|
| Synonyms | Retinol, Dihydrogen Phosphate; Retinyl Phosphate; Retinylphosphate |
| Molecular Structure | ![]() |
| Molecular Formula | C20H31O4P |
| Molecular Weight | 366.44 |
| CAS Registry Number | 53859-19-1 |
| SMILES | C(O[P](=O)(O)O)\C=C(C)\C=C\C=C(C)/C=C/C1=C(C)CCCC1(C)C |
| InChI | 1S/C20H31O4P/c1-16(8-6-9-17(2)13-15-24-25(21,22)23)11-12-19-18(3)10-7-14-20(19,4)5/h6,8-9,11-13H,7,10,14-15H2,1-5H3,(H2,21,22,23)/b9-6+,12-11+,16-8-,17-13+ |
| InChIKey | PDRZOMUQUZBNKV-MKOSUFFBSA-N |
| Density | 1.117g/cm3 (Cal.) |
|---|---|
| Boiling point | 523.675°C at 760 mmHg (Cal.) |
| Flash point | 270.509°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Retinol Phosphate |