|
CAS#: 5386-77-6 Product: O-[2,4-Dinitro-6-(2-Octanyl)Phenyl] S-Methyl Carbonothioate No suppilers available for the product. |
| Name | O-[2,4-Dinitro-6-(2-Octanyl)Phenyl] S-Methyl Carbonothioate |
|---|---|
| Molecular Structure | ![]() |
| Molecular Formula | C16H22N2O6S |
| Molecular Weight | 370.42 |
| CAS Registry Number | 5386-77-6 |
| SMILES | [O-][N+](=O)c1cc(cc(C(C)CCCCCC)c1OC(=O)SC)[N+]([O-])=O |
| InChI | 1S/C16H22N2O6S/c1-4-5-6-7-8-11(2)13-9-12(17(20)21)10-14(18(22)23)15(13)24-16(19)25-3/h9-11H,4-8H2,1-3H3 |
| InChIKey | PTKVPQXEKZOPNA-UHFFFAOYSA-N |
| Density | 1.246g/cm3 (Cal.) |
|---|---|
| Boiling point | 469.12°C at 760 mmHg (Cal.) |
| Flash point | 237.516°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for O-[2,4-Dinitro-6-(2-Octanyl)Phenyl] S-Methyl Carbonothioate |