Online Database of Chemicals from Around the World
| BOC Sciences | USA | Inquire | ||
|---|---|---|---|---|
 |
+1 (631) 485-4226 | |||
 |
info@bocsci.com | |||
 |
Skype Chat | |||
| Chemical distributor | ||||
| chemBlink massive supplier since 2012 | ||||
| International Laboratory Limited | USA | Inquire | ||
|---|---|---|---|---|
|
+1 (650) 278-9963 | |||
|
admin@intlab.org | |||
| Chemical manufacturer since 2002 | ||||
| Name | 1,3,5[10]-Estratriene-2,4-dideuterio-3,17beta-Diol |
|---|---|
| Synonyms | 2,4-Dideuterioestradiol; Estra-1,3,5(10)-Triene-2,4-D2-3,17-Diol, (17-Beta)- |
| Molecular Structure | ![CAS#: 53866-33-4, 1,3,5[10]-Estratriene-2,4-dideuterio-3,17beta-Diol](/moreStructures/53866-33-4.gif) |
| Molecular Formula | C18H22D2O2 |
| Molecular Weight | 274.40 |
| CAS Registry Number | 53866-33-4 |
| SMILES | [C@@H]4(O)C3(C(C2C(C1=C(C(=C(O)C(=C1)[2H])[2H])CC2)CC3)CC4)C |
| InChI | 1S/C18H24O2/c1-18-9-8-14-13-5-3-12(19)10-11(13)2-4-15(14)16(18)6-7-17(18)20/h3,5,10,14-17,19-20H,2,4,6-9H2,1H3/t14?,15?,16?,17-,18?/m0/s1/i3D,10D |
| InChIKey | VOXZDWNPVJITMN-CKJOQQCQSA-N |
| Density | 1.179g/cm3 (Cal.) |
|---|---|
| Boiling point | 445.917°C at 760 mmHg (Cal.) |
| Flash point | 209.634°C (Cal.) |
| SDS | Available |
|---|---|
| Market Analysis Reports |
| List of Reports Available for 1,3,5[10]-Estratriene-2,4-dideuterio-3,17beta-Diol |