|
CAS#: 53905-37-6 Product: 4,4'-Dichloro-(1,1'-Biphenyl)-3,3'-Diol No suppilers available for the product. |
| Name | 4,4'-Dichloro-(1,1'-Biphenyl)-3,3'-Diol |
|---|---|
| Synonyms | 2-Chloro-5-(4-Chloro-3-Hydroxy-Phenyl)Phenol; 4,4'-Dichloro[1,1'-Biphenyl]-3,3'-Diol; [1,1'-Biphenyl]-3,3'-Diol, 4,4'-Dichloro- |
| Molecular Structure | ![]() |
| Molecular Formula | C12H8Cl2O2 |
| Molecular Weight | 255.10 |
| CAS Registry Number | 53905-37-6 |
| SMILES | C1=C(C(=CC=C1C2=CC(=C(Cl)C=C2)O)Cl)O |
| InChI | 1S/C12H8Cl2O2/c13-9-3-1-7(5-11(9)15)8-2-4-10(14)12(16)6-8/h1-6,15-16H |
| InChIKey | HCMZQOFFKKISQI-UHFFFAOYSA-N |
| Density | 1.454g/cm3 (Cal.) |
|---|---|
| Boiling point | 416.088°C at 760 mmHg (Cal.) |
| Flash point | 205.443°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 4,4'-Dichloro-(1,1'-Biphenyl)-3,3'-Diol |