|
CAS#: 5393-85-1 Product: 1,3-Bis(5-Isocyanato-2-Methyl-Phenyl)-1,3-Diazetidine-2,4-Dione No suppilers available for the product. |
| Name | 1,3-Bis(5-Isocyanato-2-Methyl-Phenyl)-1,3-Diazetidine-2,4-Dione |
|---|---|
| Synonyms | 1,3-Bis(5-Isocyanato-2-Methyl-Phenyl)-1,3-Diazetidine-2,4-Dione; 1,3-Bis(5-Isocyanato-2-Methyl-Phenyl)-1,3-Diazetidine-2,4-Quinone; Nsc4812 |
| Molecular Structure | ![]() |
| Molecular Formula | C18H12N4O4 |
| Molecular Weight | 348.32 |
| CAS Registry Number | 5393-85-1 |
| SMILES | O=C=NC1=CC(=C(C)C=C1)N2C(=O)N(C2=O)C3=C(C=CC(=C3)N=C=O)C |
| InChI | 1S/C18H12N4O4/c1-11-3-5-13(19-9-23)7-15(11)21-17(25)22(18(21)26)16-8-14(20-10-24)6-4-12(16)2/h3-8H,1-2H3 |
| InChIKey | WCUIIQMWKGRYPH-UHFFFAOYSA-N |
| Density | 1.365g/cm3 (Cal.) |
|---|---|
| Boiling point | 497.149°C at 760 mmHg (Cal.) |
| Flash point | 254.467°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1,3-Bis(5-Isocyanato-2-Methyl-Phenyl)-1,3-Diazetidine-2,4-Dione |