|
CAS#: 53955-22-9 Product: 2,5-Dimethyl-3-Propyl-1H-Indole No suppilers available for the product. |
| Name | 2,5-Dimethyl-3-Propyl-1H-Indole |
|---|---|
| Synonyms | Nsc163171 |
| Molecular Structure | ![]() |
| Molecular Formula | C13H17N |
| Molecular Weight | 187.28 |
| CAS Registry Number | 53955-22-9 |
| SMILES | C2=C1C(=C([NH]C1=CC=C2C)C)CCC |
| InChI | 1S/C13H17N/c1-4-5-11-10(3)14-13-7-6-9(2)8-12(11)13/h6-8,14H,4-5H2,1-3H3 |
| InChIKey | ORRREROEJOYMCE-UHFFFAOYSA-N |
| Density | 1.019g/cm3 (Cal.) |
|---|---|
| Boiling point | 327.504°C at 760 mmHg (Cal.) |
| Flash point | 139.416°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2,5-Dimethyl-3-Propyl-1H-Indole |