|
CAS#: 53970-64-2 Product: 2,3-Dihydro-5-Methyl-1H-Cyclopenta[b]Quinolin-9-Amine No suppilers available for the product. |
| Name | 2,3-Dihydro-5-Methyl-1H-Cyclopenta[b]Quinolin-9-Amine |
|---|---|
| Synonyms | (5-Methyl-2,3-Dihydro-1H-Cyclopenta[B]Quinolin-9-Yl)Amine; Oprea1_087254; Oprea1_291552 |
| Molecular Structure | ![]() |
| Molecular Formula | C13H14N2 |
| Molecular Weight | 198.27 |
| CAS Registry Number | 53970-64-2 |
| SMILES | C3=C(C1=C(C(=C2C(=N1)CCC2)N)C=C3)C |
| InChI | 1S/C13H14N2/c1-8-4-2-6-10-12(14)9-5-3-7-11(9)15-13(8)10/h2,4,6H,3,5,7H2,1H3,(H2,14,15) |
| InChIKey | QOLOQNUWZYKSGE-UHFFFAOYSA-N |
| Density | 1.206g/cm3 (Cal.) |
|---|---|
| Boiling point | 406.506°C at 760 mmHg (Cal.) |
| Flash point | 228.652°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2,3-Dihydro-5-Methyl-1H-Cyclopenta[b]Quinolin-9-Amine |