Online Database of Chemicals from Around the World
|
CAS#: 5398-75-4 Product: 1-Methyl-7-Propan-2-Yl-Phenanthrene-9,10-Dione No suppilers available for the product. |
| Name | 1-Methyl-7-Propan-2-Yl-Phenanthrene-9,10-Dione |
|---|---|
| Synonyms | 7-Isopropyl-1-Methyl-Phenanthrene-9,10-Dione; 7-Isopropyl-1-Methylphenanthrene-9,10-Dione; 7-Isopropyl-1-Methyl-Phenanthrene-9,10-Quinone |
| Molecular Structure |  |
| Molecular Formula | C18H16O2 |
| Molecular Weight | 264.32 |
| CAS Registry Number | 5398-75-4 |
| SMILES | C1=CC=C(C3=C1C2=CC=C(C=C2C(C3=O)=O)C(C)C)C |
| InChI | 1S/C18H16O2/c1-10(2)12-7-8-13-14-6-4-5-11(3)16(14)18(20)17(19)15(13)9-12/h4-10H,1-3H3 |
| InChIKey | WVOVXOXRXQFTAS-UHFFFAOYSA-N |
| Density | 1.173g/cm3 (Cal.) |
|---|---|
| Boiling point | 438.78°C at 760 mmHg (Cal.) |
| Flash point | 187.939°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1-Methyl-7-Propan-2-Yl-Phenanthrene-9,10-Dione |