|
CAS#: 539854-53-0 Product: 2-(4'-Methyl-4-Biphenylyl)-4,6-Bis(Trichloromethyl)-1,3,5-Triazine No suppilers available for the product. |
| Name | 2-(4'-Methyl-4-Biphenylyl)-4,6-Bis(Trichloromethyl)-1,3,5-Triazine |
|---|---|
| Synonyms | 1,3,5-Tri |
| Molecular Structure | ![]() |
| Molecular Formula | C18H11Cl6N3 |
| Molecular Weight | 482.02 |
| CAS Registry Number | 539854-53-0 |
| SMILES | Cc1ccc(cc1)c2ccc(cc2)c3nc(nc(n3)C(Cl)(Cl)Cl)C(Cl)(Cl)Cl |
| InChI | 1S/C18H11Cl6N3/c1-10-2-4-11(5-3-10)12-6-8-13(9-7-12)14-25-15(17(19,20)21)27-16(26-14)18(22,23)24/h2-9H,1H3 |
| InChIKey | GAIXIQROKLDDGK-UHFFFAOYSA-N |
| Density | 1.5±0.1g/cm3 (Cal.) |
|---|---|
| Boiling point | 533.9±60.0°C at 760 mmHg (Cal.) |
| Flash point | 307.3±18.5°C (Cal.) |
| Refractive index | 1.625 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2-(4'-Methyl-4-Biphenylyl)-4,6-Bis(Trichloromethyl)-1,3,5-Triazine |