|
CAS#: 54023-73-3 Product: 4-[(4-Acetylphenyl)Imino]-2,5-Cyclohexadien-1-One No suppilers available for the product. |
| Name | 4-[(4-Acetylphenyl)Imino]-2,5-Cyclohexadien-1-One |
|---|---|
| Synonyms | 4-(4-Acetylphenyl)Imino-1-Cyclohexa-2,5-Dienone; 4-(4-Ethanoylphenyl)Iminocyclohexa-2,5-Dien-1-One; 2,5-Cyclohexadien-1-One, 4-(P-Acetylphenyl)Imino- |
| Molecular Structure | ![]() |
| Molecular Formula | C14H11NO2 |
| Molecular Weight | 225.25 |
| CAS Registry Number | 54023-73-3 |
| SMILES | C2=C(N=C1C=CC(=O)C=C1)C=CC(=C2)C(=O)C |
| InChI | 1S/C14H11NO2/c1-10(16)11-2-4-12(5-3-11)15-13-6-8-14(17)9-7-13/h2-9H,1H3 |
| InChIKey | PBIJFJHLHBBUFV-UHFFFAOYSA-N |
| Density | 1.13g/cm3 (Cal.) |
|---|---|
| Boiling point | 376.453°C at 760 mmHg (Cal.) |
| Flash point | 155.33°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 4-[(4-Acetylphenyl)Imino]-2,5-Cyclohexadien-1-One |