Online Database of Chemicals from Around the World
| BOC Sciences | USA | Inquire | ||
|---|---|---|---|---|
 |
+1 (631) 485-4226 | |||
 |
info@bocsci.com | |||
 |
Skype Chat | |||
| Chemical distributor | ||||
| chemBlink massive supplier since 2012 | ||||
| Name | 2-Isothiocyanatopyridine, Dimer |
|---|---|
| Synonyms | 3-(2-Pyridyl)Pyrido[2,1-F][1,3,5]Triazine-2,4-Dithione; Nsc155040 |
| Molecular Structure |  |
| Molecular Formula | C12H8N4S2 |
| Molecular Weight | 272.34 |
| CAS Registry Number | 54026-17-4 |
| SMILES | C3=C(N1C(N2C(=NC1=S)C=CC=C2)=S)N=CC=C3 |
| InChI | 1S/C12H8N4S2/c17-11-14-10-6-2-4-8-15(10)12(18)16(11)9-5-1-3-7-13-9/h1-8H |
| InChIKey | UJOKWUUEVJNBCX-UHFFFAOYSA-N |
| Density | 1.444g/cm3 (Cal.) |
|---|---|
| Boiling point | 414.356°C at 760 mmHg (Cal.) |
| Flash point | 204.395°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2-Isothiocyanatopyridine, Dimer |