| Otava Ltd. | Ukraine | Inquire | ||
|---|---|---|---|---|
![]() |
+380 (44) 522-2458 | |||
![]() |
order@otavachemicals.com | |||
| Chemical manufacturer since 1997 | ||||
| Name | 2-(2-Chlorophenyl)-1,3-Dioxane |
|---|---|
| Synonyms | Nsc6999 |
| Molecular Structure | ![]() |
| Molecular Formula | C10H11ClO2 |
| Molecular Weight | 198.65 |
| CAS Registry Number | 5406-38-2 |
| SMILES | C1=CC(=C(C=C1)Cl)C2OCCCO2 |
| InChI | 1S/C10H11ClO2/c11-9-5-2-1-4-8(9)10-12-6-3-7-13-10/h1-2,4-5,10H,3,6-7H2 |
| InChIKey | KTTHLCQZVJBPDW-UHFFFAOYSA-N |
| Density | 1.206g/cm3 (Cal.) |
|---|---|
| Boiling point | 274.024°C at 760 mmHg (Cal.) |
| Flash point | 106.09°C (Cal.) |
| (1) | Xiao-Yong Wang, Jiang-Hua Shi, Min Zhang and Seik Weng Ng . 3,9-Bis(2-chlorophenyl)-2,4,8,10-tetraoxaspiro[5.5]undecane , Acta Cryst (2010). E66, o426Â Â |
|---|---|
| Market Analysis Reports |
| List of Reports Available for 2-(2-Chlorophenyl)-1,3-Dioxane |