|
CAS#: 5410-54-8 Product: 1-Naphtylarsonic Acid No suppilers available for the product. |
| Name | 1-Naphtylarsonic Acid |
|---|---|
| Synonyms | 1-Naphthylarsonic Acid; 4-16-00-01185 (Beilstein Handbook Reference); Brn 3530489 |
| Molecular Structure | ![]() |
| Molecular Formula | C10H9AsO3 |
| Molecular Weight | 252.10 |
| CAS Registry Number | 5410-54-8 |
| SMILES | C2=CC=C1C=CC=CC1=C2[As](=O)(O)O |
| InChI | 1S/C10H9AsO3/c12-11(13,14)10-7-3-5-8-4-1-2-6-9(8)10/h1-7H,(H2,12,13,14) |
| InChIKey | XUMIJWCAWDYMOE-UHFFFAOYSA-N |
| Boiling point | 530.443°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 288.677°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1-Naphtylarsonic Acid |