|
CAS#: 54145-81-2 Product: 2-[(1R,4S,6S)-1-Methyl-7-Oxabicyclo[4.1.0]Heptan-4-Yl]Propan-2-Ol No suppilers available for the product. |
| Name | 2-[(1R,4S,6S)-1-Methyl-7-Oxabicyclo[4.1.0]Heptan-4-Yl]Propan-2-Ol |
|---|---|
| Synonyms | (1Alpha,3Beta,6Alpha)-Alpha,Alpha,6-Trimethyl-7-Oxabicyclo(4.1.0)Heptane-3-Methanol |
| Molecular Structure | ![]() |
| Molecular Formula | C10H18O2 |
| Molecular Weight | 170.25 |
| CAS Registry Number | 54145-81-2 |
| EINECS | 258-998-0 |
| SMILES | [C@@H]12O[C@@]1(CC[C@@H](C2)C(O)(C)C)C |
| InChI | 1S/C10H18O2/c1-9(2,11)7-4-5-10(3)8(6-7)12-10/h7-8,11H,4-6H2,1-3H3/t7-,8-,10+/m0/s1 |
| InChIKey | HSMACHQZLSQBIN-OYNCUSHFSA-N |
| Density | 1.076g/cm3 (Cal.) |
|---|---|
| Boiling point | 253.626°C at 760 mmHg (Cal.) |
| Flash point | 100.122°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2-[(1R,4S,6S)-1-Methyl-7-Oxabicyclo[4.1.0]Heptan-4-Yl]Propan-2-Ol |