|
CAS#: 54170-19-3 Product: 2,2-Diethoxyethyl(Methyl)Ammonium Chloride No suppilers available for the product. |
| Name | 2,2-Diethoxyethyl(Methyl)Ammonium Chloride |
|---|---|
| Synonyms | 2,2-Diethoxyethyl-Methyl-Ammonium Chloride; 2,2-Diethoxyethyl-Methylammonium Chloride; 2,2-Diethoxyethyl-Methyl-Azanium Chloride |
| Molecular Structure | ![]() |
| Molecular Formula | C7H18ClNO2 |
| Molecular Weight | 183.68 |
| CAS Registry Number | 54170-19-3 |
| EINECS | 259-010-0 |
| SMILES | C([NH2+]C)C(OCC)OCC.[Cl-] |
| InChI | 1S/C7H17NO2.ClH/c1-4-9-7(6-8-3)10-5-2;/h7-8H,4-6H2,1-3H3;1H |
| InChIKey | KZYYTQBPRJNKFR-UHFFFAOYSA-N |
| Boiling point | 162.8°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 61.5°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2,2-Diethoxyethyl(Methyl)Ammonium Chloride |