|
CAS#: 54210-47-8 Product: 3-Methylbutyl 4-Cyanobenzoate No suppilers available for the product. |
| Name | 3-Methylbutyl 4-Cyanobenzoate |
|---|---|
| Synonyms | 4-Cyanobenzoic acid, 3-methylbutyl ester; Isopentyl 4-cyanobenzoate # |
| Molecular Structure | ![]() |
| Molecular Formula | C13H15NO2 |
| Molecular Weight | 217.26 |
| CAS Registry Number | 54210-47-8 |
| SMILES | N#Cc1ccc(C(=O)OCCC(C)C)cc1 |
| InChI | 1S/C13H15NO2/c1-10(2)7-8-16-13(15)12-5-3-11(9-14)4-6-12/h3-6,10H,7-8H2,1-2H3 |
| InChIKey | HNGBOMOWBIPNBH-UHFFFAOYSA-N |
| Density | 1.073g/cm3 (Cal.) |
|---|---|
| Boiling point | 336.79°C at 760 mmHg (Cal.) |
| Flash point | 159.37°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 3-Methylbutyl 4-Cyanobenzoate |