Online Database of Chemicals from Around the World
|
CAS#: 54221-01-1 Product: 5-(3-Hydroxy-3-Methylbutyl)-3-Methyl-3-Cyclohexene-1-Carbaldehyde No suppilers available for the product. |
| Name | 5-(3-Hydroxy-3-Methylbutyl)-3-Methyl-3-Cyclohexene-1-Carbaldehyde |
|---|---|
| Synonyms | 5-(3-Hydroxy-3-Methyl-Butyl)-3-Methyl-Cyclohex-3-Ene-1-Carbaldehyde; 5-(3-Hydroxy-3-Methylbutyl)-3-Methyl-1-Cyclohex-3-Enecarboxaldehyde; 1-Formyl-3-Methyl-5-(3-Methyl-3-Hydroxybutyl)-3-Cyclohexene |
| Molecular Structure |  |
| Molecular Formula | C13H22O2 |
| Molecular Weight | 210.32 |
| CAS Registry Number | 54221-01-1 |
| SMILES | C(C1CC(C=O)CC(=C1)C)CC(O)(C)C |
| InChI | 1S/C13H22O2/c1-10-6-11(4-5-13(2,3)15)8-12(7-10)9-14/h6,9,11-12,15H,4-5,7-8H2,1-3H3 |
| InChIKey | SEUIEHGGUUGHEY-UHFFFAOYSA-N |
| Density | 1.006g/cm3 (Cal.) |
|---|---|
| Boiling point | 308.429°C at 760 mmHg (Cal.) |
| Flash point | 130.428°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 5-(3-Hydroxy-3-Methylbutyl)-3-Methyl-3-Cyclohexene-1-Carbaldehyde |