|
CAS#: 5423-70-1 Product: 6-Methyl-10-Phenanthridinamine No suppilers available for the product. |
| Name | 6-Methyl-10-Phenanthridinamine |
|---|---|
| Synonyms | 6-Methyl-10-Phenanthridinamine; (6-Methylphenanthridin-10-Yl)Amine; Nsc13237 |
| Molecular Structure | ![]() |
| Molecular Formula | C14H12N2 |
| Molecular Weight | 208.26 |
| CAS Registry Number | 5423-70-1 |
| SMILES | C1=C2C(=C(N)C=C1)C3=C(N=C2C)C=CC=C3 |
| InChI | 1S/C14H12N2/c1-9-10-6-4-7-12(15)14(10)11-5-2-3-8-13(11)16-9/h2-8H,15H2,1H3 |
| InChIKey | VAPUUTKGROVHHN-UHFFFAOYSA-N |
| Density | 1.229g/cm3 (Cal.) |
|---|---|
| Boiling point | 420.684°C at 760 mmHg (Cal.) |
| Flash point | 237.725°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 6-Methyl-10-Phenanthridinamine |