|
CAS#: 54262-54-3 Product: Northiaden S-Oxide No suppilers available for the product. |
| Name | Northiaden S-Oxide |
|---|---|
| Synonyms | 1-Propanamine, 3-Dibenzo(B,E)Thiepin-11(6H)-Ylidene-N-Methyl-, S-Oxide; Northiaden S-Oxide |
| Molecular Structure | ![]() |
| Molecular Formula | C18H19NOS |
| Molecular Weight | 297.41 |
| CAS Registry Number | 54262-54-3 |
| SMILES | C1=CC=CC2=C1\C(C3=C(C[S]2=O)C=CC=C3)=C/CCNC |
| InChI | 1S/C18H19NOS/c1-19-12-6-10-16-15-8-3-2-7-14(15)13-21(20)18-11-5-4-9-17(16)18/h2-5,7-11,19H,6,12-13H2,1H3/b16-10- |
| InChIKey | XBXURVRTJAZSCN-YBEGLDIGSA-N |
| Density | 1.239g/cm3 (Cal.) |
|---|---|
| Boiling point | 509.301°C at 760 mmHg (Cal.) |
| Flash point | 261.816°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Northiaden S-Oxide |