Online Database of Chemicals from Around the World
|
CAS#: 5427-08-7 Product: 1-Hydroxy-2,6-Di-Tert-Butyl-4-Cyclohexylbenzene No suppilers available for the product. |
| Name | 1-Hydroxy-2,6-Di-Tert-Butyl-4-Cyclohexylbenzene |
|---|---|
| Synonyms | 2,6-Ditert-Butyl-4-Cyclohexyl-Phenol; 1-Hydroxy-2,6-Di-Tert-Butyl-4-Cyclohexylbenzene; 2,6-Di-Tert-Butyl-4-Cyclohexylphenol |
| Molecular Structure |  |
| Molecular Formula | C20H32O |
| Molecular Weight | 288.47 |
| CAS Registry Number | 5427-08-7 |
| SMILES | C1=C(C(=C(C(C)(C)C)C=C1C2CCCCC2)O)C(C)(C)C |
| InChI | 1S/C20H32O/c1-19(2,3)16-12-15(14-10-8-7-9-11-14)13-17(18(16)21)20(4,5)6/h12-14,21H,7-11H2,1-6H3 |
| InChIKey | CDSVIAVJONAPBL-UHFFFAOYSA-N |
| Density | 0.954g/cm3 (Cal.) |
|---|---|
| Boiling point | 344.629°C at 760 mmHg (Cal.) |
| Flash point | 155.311°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1-Hydroxy-2,6-Di-Tert-Butyl-4-Cyclohexylbenzene |