|
CAS#: 54284-31-0 Product: N-Methyl-N-(2-Methyl-2-Propanyl)-4-Nitrobenzamide No suppilers available for the product. |
| Name | N-Methyl-N-(2-Methyl-2-Propanyl)-4-Nitrobenzamide |
|---|---|
| Synonyms | N-(tert-Butyl)-N-methyl-4-nitrobenzamide # |
| Molecular Structure | ![]() |
| Molecular Formula | C12H16N2O3 |
| Molecular Weight | 236.27 |
| CAS Registry Number | 54284-31-0 |
| SMILES | O=[N+]([O-])c1ccc(C(=O)N(C(C)(C)C)C)cc1 |
| InChI | 1S/C12H16N2O3/c1-12(2,3)13(4)11(15)9-5-7-10(8-6-9)14(16)17/h5-8H,1-4H3 |
| InChIKey | OWQGSQOMTFYNHF-UHFFFAOYSA-N |
| Density | 1.146g/cm3 (Cal.) |
|---|---|
| Boiling point | 384.353°C at 760 mmHg (Cal.) |
| Flash point | 186.25°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for N-Methyl-N-(2-Methyl-2-Propanyl)-4-Nitrobenzamide |