|
CAS#: 54313-75-6 Product: 1-(3-Pyridyl)-1-Hydroxy-3-Phenyl-2-Propene No suppilers available for the product. |
| Name | 1-(3-Pyridyl)-1-Hydroxy-3-Phenyl-2-Propene |
|---|---|
| Synonyms | (E)-3-Phenyl-1-(3-Pyridyl)Prop-2-En-1-Ol; (E)-3-Phenyl-1-Pyridin-3-Yl-Prop-2-En-1-Ol; 1-(3-Pyridyl)-1-Hydroxy-3-Phenyl-2-Propene |
| Molecular Structure | ![]() |
| Molecular Formula | C14H13NO |
| Molecular Weight | 211.26 |
| CAS Registry Number | 54313-75-6 |
| SMILES | C2=C(C(O)\C=C\C1=CC=CC=C1)C=CC=N2 |
| InChI | 1S/C14H13NO/c16-14(13-7-4-10-15-11-13)9-8-12-5-2-1-3-6-12/h1-11,14,16H/b9-8+ |
| InChIKey | VSRIZGGWJMIHIO-CMDGGOBGSA-N |
| Density | 1.157g/cm3 (Cal.) |
|---|---|
| Boiling point | 402.446°C at 760 mmHg (Cal.) |
| Flash point | 197.193°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1-(3-Pyridyl)-1-Hydroxy-3-Phenyl-2-Propene |