|
CAS#: 5434-38-8 Product: (2-Methyl-5-Nitro-Phenyl)Arsonic Acid No suppilers available for the product. |
| Name | (2-Methyl-5-Nitro-Phenyl)Arsonic Acid |
|---|---|
| Synonyms | (2-Methyl-5-Nitro-Phenyl)Arsonic Acid; Antineoplastic-15574; Nsc15574 |
| Molecular Structure | ![]() |
| Molecular Formula | C7H8AsNO5 |
| Molecular Weight | 261.07 |
| CAS Registry Number | 5434-38-8 |
| SMILES | C1=CC(=CC(=C1C)[As](O)(O)=O)[N+]([O-])=O |
| InChI | 1S/C7H8AsNO5/c1-5-2-3-6(9(13)14)4-7(5)8(10,11)12/h2-4H,1H3,(H2,10,11,12) |
| InChIKey | QIYPYANJTKRINI-UHFFFAOYSA-N |
| Boiling point | 543.637°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 241.035°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for (2-Methyl-5-Nitro-Phenyl)Arsonic Acid |