|
CAS#: 54351-43-8 Product: 3-Acetyl-5-(D-arabino-tetrahydrobutyl)-2-methylpyrrole No suppilers available for the product. |
| Name | 3-Acetyl-5-(D-arabino-tetrahydrobutyl)-2-methylpyrrole |
|---|---|
| Synonyms | 3-Acetyl-5-(D-Arabino-Tetrahydrobutyl)-2-Methylpyrrole; Ver I; Wer I |
| Molecular Structure | ![]() |
| Molecular Formula | C11H17NO5 |
| Molecular Weight | 243.26 |
| CAS Registry Number | 54351-43-8 |
| SMILES | [C@@H](C1=CC(=C([NH]1)C)C(C)=O)([C@@H]([C@@H](CO)O)O)O |
| InChI | 1S/C11H17NO5/c1-5-7(6(2)14)3-8(12-5)10(16)11(17)9(15)4-13/h3,9-13,15-17H,4H2,1-2H3/t9-,10-,11-/m1/s1 |
| InChIKey | OTGHXPARZDXDIM-GMTAPVOTSA-N |
| Density | 1.407g/cm3 (Cal.) |
|---|---|
| Boiling point | 575.221°C at 760 mmHg (Cal.) |
| Flash point | 301.683°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 3-Acetyl-5-(D-arabino-tetrahydrobutyl)-2-methylpyrrole |