|
CAS#: 5436-70-4 Product: 2-(2,4-Dichlorophenyl)-4,5-Dimethyl-1,3-Dioxolane No suppilers available for the product. |
| Name | 2-(2,4-Dichlorophenyl)-4,5-Dimethyl-1,3-Dioxolane |
|---|---|
| Synonyms | Nsc21761 |
| Molecular Structure | ![]() |
| Molecular Formula | C11H12Cl2O2 |
| Molecular Weight | 247.12 |
| CAS Registry Number | 5436-70-4 |
| SMILES | C1=CC(=CC(=C1C2OC(C(C)O2)C)Cl)Cl |
| InChI | 1S/C11H12Cl2O2/c1-6-7(2)15-11(14-6)9-4-3-8(12)5-10(9)13/h3-7,11H,1-2H3 |
| InChIKey | DVLVFLFFNDBRJB-UHFFFAOYSA-N |
| Density | 1.243g/cm3 (Cal.) |
|---|---|
| Boiling point | 296.898°C at 760 mmHg (Cal.) |
| Flash point | 107.377°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2-(2,4-Dichlorophenyl)-4,5-Dimethyl-1,3-Dioxolane |