|
CAS#: 54381-26-9 Product: O-2-Chloro-4-(methylthio)phenyl O-methyl ethylphosphorothioamidate No suppilers available for the product. |
| Name | O-2-Chloro-4-(methylthio)phenyl O-methyl ethylphosphorothioamidate |
|---|---|
| Synonyms | N-[(2-Chloro-4-Methylsulfanyl-Phenoxy)-Methoxy-Phosphinothioyl]Ethanamine; N-[[2-Chloro-4-(Methylthio)Phenoxy]-Methoxyphosphinothioyl]Ethanamine; [[2-Chloro-4-(Methylthio)Phenoxy]-Methoxy-Thiophosphoryl]-Ethyl-Amine |
| Molecular Structure | ![]() |
| Molecular Formula | C10H15ClNO2PS2 |
| Molecular Weight | 311.78 |
| CAS Registry Number | 54381-26-9 |
| SMILES | C1=C(C(=CC=C1SC)O[P](=S)(OC)NCC)Cl |
| InChI | 1S/C10H15ClNO2PS2/c1-4-12-15(16,13-2)14-10-6-5-8(17-3)7-9(10)11/h5-7H,4H2,1-3H3,(H,12,16) |
| InChIKey | KHHCRIPDPIOVAF-UHFFFAOYSA-N |
| Density | 1.328g/cm3 (Cal.) |
|---|---|
| Boiling point | 376.888°C at 760 mmHg (Cal.) |
| Flash point | 181.736°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for O-2-Chloro-4-(methylthio)phenyl O-methyl ethylphosphorothioamidate |