|
CAS#: 54391-31-0 Product: 2,2'-Diiodobiphenyl-4,4'-Diamine No suppilers available for the product. |
| Name | 2,2'-Diiodobiphenyl-4,4'-Diamine |
|---|---|
| Synonyms | 4-(4-Amino-2-Iodo-Phenyl)-3-Iodo-Aniline; [4-(4-Amino-2-Iodo-Phenyl)-3-Iodo-Phenyl]Amine; Nsc170080 |
| Molecular Structure | ![]() |
| Molecular Formula | C12H10I2N2 |
| Molecular Weight | 436.03 |
| CAS Registry Number | 54391-31-0 |
| SMILES | C1=CC(=CC(=C1C2=C(I)C=C(N)C=C2)I)N |
| InChI | 1S/C12H10I2N2/c13-11-5-7(15)1-3-9(11)10-4-2-8(16)6-12(10)14/h1-6H,15-16H2 |
| InChIKey | PGJJPWRSBHDEOP-UHFFFAOYSA-N |
| Density | 2.143g/cm3 (Cal.) |
|---|---|
| Boiling point | 490.582°C at 760 mmHg (Cal.) |
| Flash point | 250.495°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2,2'-Diiodobiphenyl-4,4'-Diamine |