Online Database of Chemicals from Around the World
| Alfa Chemistry | USA | Inquire | ||
|---|---|---|---|---|
 |
+1 (201) 478-8534 | |||
 |
inquiry@alfa-chemistry.com | |||
| Chemical distributor since 2012 | ||||
| chemBlink standard supplier since 2012 | ||||
| BOC Sciences | USA | Inquire | ||
|---|---|---|---|---|
|
+1 (631) 485-4226 | |||
|
info@bocsci.com | |||
 |
Skype Chat | |||
| Chemical distributor | ||||
| chemBlink massive supplier since 2012 | ||||
| Name | 2-(Methylthio)-Propanal 2-(2,4-Dinitrophenyl)Hydrazone |
|---|---|
| Synonyms | N-(2-Methylsulfanylpropylideneamino)-2,4-Dinitro-Aniline; N-[2-(Methylthio)Propylideneamino]-2,4-Dinitroaniline; (2,4-Dinitrophenyl)-[2-(Methylthio)Propylideneamino]Amine |
| Molecular Structure |  |
| Molecular Formula | C10H12N4O4S |
| Molecular Weight | 284.29 |
| CAS Registry Number | 5440-68-6 |
| SMILES | C1=CC(=CC(=C1N\N=C\C(C)SC)[N+]([O-])=O)[N+]([O-])=O |
| InChI | 1S/C10H12N4O4S/c1-7(19-2)6-11-12-9-4-3-8(13(15)16)5-10(9)14(17)18/h3-7,12H,1-2H3/b11-6+ |
| InChIKey | MDTLCKSUWLYASZ-IZZDOVSWSA-N |
| Density | 1.435g/cm3 (Cal.) |
|---|---|
| Boiling point | 433.735°C at 760 mmHg (Cal.) |
| Flash point | 216.115°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2-(Methylthio)-Propanal 2-(2,4-Dinitrophenyl)Hydrazone |