|
CAS#: 5441-26-9 Product: 2-[Methoxy-(2-Methoxyphenyl)Methyl]Benzoic Acid No suppilers available for the product. |
| Name | 2-[Methoxy-(2-Methoxyphenyl)Methyl]Benzoic Acid |
|---|---|
| Synonyms | Nsc21254 |
| Molecular Structure | ![]() |
| Molecular Formula | C16H16O4 |
| Molecular Weight | 272.30 |
| CAS Registry Number | 5441-26-9 |
| SMILES | C1=CC=CC(=C1C(C2=C(C=CC=C2)C(=O)O)OC)OC |
| InChI | 1S/C16H16O4/c1-19-14-10-6-5-9-13(14)15(20-2)11-7-3-4-8-12(11)16(17)18/h3-10,15H,1-2H3,(H,17,18) |
| InChIKey | BSZVPIUZRZUMFY-UHFFFAOYSA-N |
| Density | 1.189g/cm3 (Cal.) |
|---|---|
| Boiling point | 421.185°C at 760 mmHg (Cal.) |
| Flash point | 154.359°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2-[Methoxy-(2-Methoxyphenyl)Methyl]Benzoic Acid |