| Name | 2,4-Dinitrophenyl Diethyl Phosphate |
|---|---|
| Synonyms | Phosphoric Acid (2,4-Dinitrophenyl) Diethyl Ester; 2,4-Dinitrophenyl Diethyl Phosphate; Dndep |
| Molecular Structure | ![]() |
| Molecular Formula | C10H13N2O8P |
| Molecular Weight | 320.20 |
| CAS Registry Number | 54436-53-2 |
| SMILES | C1=CC(=CC(=C1O[P](OCC)(=O)OCC)[N+]([O-])=O)[N+]([O-])=O |
| InChI | 1S/C10H13N2O8P/c1-3-18-21(17,19-4-2)20-10-6-5-8(11(13)14)7-9(10)12(15)16/h5-7H,3-4H2,1-2H3 |
| InChIKey | RHDGEDJQNNASCI-UHFFFAOYSA-N |
| Density | 1.433g/cm3 (Cal.) |
|---|---|
| Boiling point | 400.457°C at 760 mmHg (Cal.) |
| Flash point | 195.99°C (Cal.) |
| (1) | Anthony J. Kirby, Bruno S. Souza, Michelle Medeiros, Jacks P. Priebe, Alex M. Manfredi and Faruk Nome. Hydroxylamine as an oxygennucleophile. Chemical evidence from its reaction with a phosphate triester, Chem. Commun., 2008, 4428. |
|---|---|
| Market Analysis Reports |
| List of Reports Available for 2,4-Dinitrophenyl Diethyl Phosphate |