|
CAS#: 5448-50-0 Product: N-(3,5-Dibromophenyl)-2-Iodo-Acetamide No suppilers available for the product. |
| Name | N-(3,5-Dibromophenyl)-2-Iodo-Acetamide |
|---|---|
| Synonyms | N-(3,5-Dibromophenyl)-2-Iodo-Acetamide; N-(3,5-Dibromophenyl)-2-Iodo-Ethanamide; Nsc17826 |
| Molecular Structure | ![]() |
| Molecular Formula | C8H6Br2INO |
| Molecular Weight | 418.85 |
| CAS Registry Number | 5448-50-0 |
| SMILES | C1=C(Br)C=C(C=C1NC(CI)=O)Br |
| InChI | 1S/C8H6Br2INO/c9-5-1-6(10)3-7(2-5)12-8(13)4-11/h1-3H,4H2,(H,12,13) |
| InChIKey | IUVRRYJSFRICHE-UHFFFAOYSA-N |
| Density | 2.411g/cm3 (Cal.) |
|---|---|
| Boiling point | 447.209°C at 760 mmHg (Cal.) |
| Flash point | 224.264°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for N-(3,5-Dibromophenyl)-2-Iodo-Acetamide |