|
CAS#: 545-84-6 Product: Voacristine No suppilers available for the product. |
| Name | Voacristine |
|---|---|
| Synonyms | Nsc306219; Voacangarine |
| Molecular Structure | ![]() |
| Molecular Formula | C22H28N2O4 |
| Molecular Weight | 384.47 |
| CAS Registry Number | 545-84-6 |
| SMILES | [C@H]15CC2(C(N(C1)CCC3=C2[NH]C4=C3C=C(OC)C=C4)C(C5)C(O)C)C(OC)=O |
| InChI | 1S/C22H28N2O4/c1-12(25)16-8-13-10-22(21(26)28-3)19-15(6-7-24(11-13)20(16)22)17-9-14(27-2)4-5-18(17)23-19/h4-5,9,12-13,16,20,23,25H,6-8,10-11H2,1-3H3/t12?,13-,16?,20?,22?/m0/s1 |
| InChIKey | OYMQKBZMKFJPMH-BJTBUVKLSA-N |
| Density | 1.323g/cm3 (Cal.) |
|---|---|
| Boiling point | 542.855°C at 760 mmHg (Cal.) |
| Flash point | 282.109°C (Cal.) |
| SDS | Available |
|---|---|
| Market Analysis Reports |
| List of Reports Available for Voacristine |