|
CAS#: 54546-51-9 Product: 2,3-Dihydro-3-Methyl-1-Phenyl-1H-Phosphole 1-Oxide No suppilers available for the product. |
| Name | 2,3-Dihydro-3-Methyl-1-Phenyl-1H-Phosphole 1-Oxide |
|---|---|
| Synonyms | 2,3-Dihydro-3-Methyl-1-Phenyl-1H-Phosphole 1-Oxide |
| Molecular Structure | ![]() |
| Molecular Formula | C11H13OP |
| Molecular Weight | 192.20 |
| CAS Registry Number | 54546-51-9 |
| EINECS | 259-211-3 |
| SMILES | C2=C([P]1(C=CC(C1)C)=O)C=CC=C2 |
| InChI | 1S/C11H13OP/c1-10-7-8-13(12,9-10)11-5-3-2-4-6-11/h2-8,10H,9H2,1H3 |
| InChIKey | HAXGJIFBSLNBTA-UHFFFAOYSA-N |
| Density | 1.108g/cm3 (Cal.) |
|---|---|
| Boiling point | 363.061°C at 760 mmHg (Cal.) |
| Flash point | 173.373°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2,3-Dihydro-3-Methyl-1-Phenyl-1H-Phosphole 1-Oxide |