|
CAS#: 5456-26-8 Product: 2-Arsonobenzoic Acid No suppilers available for the product. |
| Name | 2-Arsonobenzoic Acid |
|---|---|
| Synonyms | Nsc15571; Mls000737788; Smr000528162 |
| Molecular Structure | ![]() |
| Molecular Formula | C7H7AsO5 |
| Molecular Weight | 246.05 |
| CAS Registry Number | 5456-26-8 |
| SMILES | C1=CC=CC(=C1[As](=O)(O)O)C(O)=O |
| InChI | 1S/C7H7AsO5/c9-7(10)5-3-1-2-4-6(5)8(11,12)13/h1-4H,(H,9,10)(H2,11,12,13) |
| InChIKey | RANIJPHIVXVUEN-UHFFFAOYSA-N |
| Boiling point | 580.214°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 318.743°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2-Arsonobenzoic Acid |