|
CAS#: 5457-42-1 Product: 2,2,4,4-Tetramethyl-3-Propan-2-Yl-Pentan-3-Ol No suppilers available for the product. |
| Name | 2,2,4,4-Tetramethyl-3-Propan-2-Yl-Pentan-3-Ol |
|---|---|
| Synonyms | 3-Isopropyl-2,2,4,4-Tetramethyl-Pentan-3-Ol; 3-Isopropyl-2,2,4,4-Tetramethylpentan-3-Ol; 2,2,4,4-Tetramethyl-3-Propan-2-Yl-Pentan-3-Ol |
| Molecular Structure | ![]() |
| Molecular Formula | C12H26O |
| Molecular Weight | 186.34 |
| CAS Registry Number | 5457-42-1 |
| SMILES | CC(C)(C)C(C(C)(C)C)(O)C(C)C |
| InChI | 1S/C12H26O/c1-9(2)12(13,10(3,4)5)11(6,7)8/h9,13H,1-8H3 |
| InChIKey | DXYPGMZJNUIZMU-UHFFFAOYSA-N |
| Density | 0.829g/cm3 (Cal.) |
|---|---|
| Boiling point | 196.389°C at 760 mmHg (Cal.) |
| Flash point | 74.279°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2,2,4,4-Tetramethyl-3-Propan-2-Yl-Pentan-3-Ol |