|
CAS#: 5458-04-8 Product: Ethylsulfanyl-(5-Nitro-2-Furyl)Methanone No suppilers available for the product. |
| Name | Ethylsulfanyl-(5-Nitro-2-Furyl)Methanone |
|---|---|
| Synonyms | 5-Nitro-2-Furancarbothioic Acid S-Ethyl Ester; 5-Nitrofuran-2-Carbothioic Acid S-Ethyl Ester; Aids-095097 |
| Molecular Structure | ![]() |
| Molecular Formula | C7H7NO4S |
| Molecular Weight | 201.20 |
| CAS Registry Number | 5458-04-8 |
| SMILES | C1=C(OC(=C1)[N+]([O-])=O)C(SCC)=O |
| InChI | 1S/C7H7NO4S/c1-2-13-7(9)5-3-4-6(12-5)8(10)11/h3-4H,2H2,1H3 |
| InChIKey | BIKPMVNWCZMWOB-UHFFFAOYSA-N |
| Density | 1.377g/cm3 (Cal.) |
|---|---|
| Boiling point | 299.464°C at 760 mmHg (Cal.) |
| Flash point | 134.911°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Ethylsulfanyl-(5-Nitro-2-Furyl)Methanone |