|
CAS#: 5458-72-0 Product: 5-Hydroxy-4-Oxo-5-Phenylpentanoic Acid No suppilers available for the product. |
| Name | 5-Hydroxy-4-Oxo-5-Phenylpentanoic Acid |
|---|---|
| Synonyms | 5-hydroxy-5-phenyllevulinic acid |
| Molecular Structure | ![]() |
| Molecular Formula | C11H12O4 |
| Molecular Weight | 208.21 |
| CAS Registry Number | 5458-72-0 |
| SMILES | O=C(O)CCC(=O)C(O)c1ccccc1 |
| InChI | 1S/C11H12O4/c12-9(6-7-10(13)14)11(15)8-4-2-1-3-5-8/h1-5,11,15H,6-7H2,(H,13,14) |
| InChIKey | UHLBGFLBWVCIHO-UHFFFAOYSA-N |
| Density | 1.287g/cm3 (Cal.) |
|---|---|
| Boiling point | 407.64°C at 760 mmHg (Cal.) |
| Flash point | 214.49°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 5-Hydroxy-4-Oxo-5-Phenylpentanoic Acid |