|
CAS#: 54593-35-0 Product: Methyl (2R)-2-(4-Hydroxyphenyl)-2-[(2R)-Piperidin-2-Yl]Acetate No suppilers available for the product. |
| Name | Methyl (2R)-2-(4-Hydroxyphenyl)-2-[(2R)-Piperidin-2-Yl]Acetate |
|---|---|
| Synonyms | Methyl (2R)-2-(4-Hydroxyphenyl)-2-[(2R)-2-Piperidyl]Acetate; (2R)-2-(4-Hydroxyphenyl)-2-[(2R)-2-Piperidinyl]Acetic Acid Methyl Ester; (2R)-2-(4-Hydroxyphenyl)-2-[(2R)-2-Piperidyl]Acetic Acid Methyl Ester |
| Molecular Structure | ![]() |
| Molecular Formula | C14H19NO3 |
| Molecular Weight | 249.31 |
| CAS Registry Number | 54593-35-0 |
| SMILES | [C@@H](C1=CC=C(O)C=C1)([C@@H]2NCCCC2)C(OC)=O |
| InChI | 1S/C14H19NO3/c1-18-14(17)13(12-4-2-3-9-15-12)10-5-7-11(16)8-6-10/h5-8,12-13,15-16H,2-4,9H2,1H3/t12-,13-/m1/s1 |
| InChIKey | XVXFNANJMMTNSO-CHWSQXEVSA-N |
| Density | 1.152g/cm3 (Cal.) |
|---|---|
| Boiling point | 379.178°C at 760 mmHg (Cal.) |
| Flash point | 183.121°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Methyl (2R)-2-(4-Hydroxyphenyl)-2-[(2R)-Piperidin-2-Yl]Acetate |