|
CAS#: 546093-13-4 Product: N-(4-Chlorobenzyl)-5-Hydroxy-4-Oxo-4H-Chromene-2-Carboxamide No suppilers available for the product. |
| Name | N-(4-Chlorobenzyl)-5-Hydroxy-4-Oxo-4H-Chromene-2-Carboxamide |
|---|---|
| Synonyms | 5-Hydroxy |
| Molecular Structure | ![]() |
| Molecular Formula | C17H12ClNO4 |
| Molecular Weight | 329.73 |
| CAS Registry Number | 546093-13-4 |
| SMILES | Clc1ccc(cc1)CNC(=O)C=3Oc2cccc(O)c2C(=O)C=3 |
| InChI | 1S/C17H12ClNO4/c18-11-6-4-10(5-7-11)9-19-17(22)15-8-13(21)16-12(20)2-1-3-14(16)23-15/h1-8,20H,9H2,(H,19,22) |
| InChIKey | WGJKPSDANGKFMV-UHFFFAOYSA-N |
| Density | 1.457g/cm3 (Cal.) |
|---|---|
| Boiling point | 582.062°C at 760 mmHg (Cal.) |
| Flash point | 305.82°C (Cal.) |
| Refractive index | 1.663 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for N-(4-Chlorobenzyl)-5-Hydroxy-4-Oxo-4H-Chromene-2-Carboxamide |