|
CAS#: 5461-85-8 Product: N-Isobutyl-N'-nitro-N-nitrosoguanidine No suppilers available for the product. |
| Name | N-Isobutyl-N'-nitro-N-nitrosoguanidine |
|---|---|
| Synonyms | [[Amino-(2-Methylpropyl-Nitrosoamino)Methylidene]Amino]-Hydroxy-Oxoazanium; 2-(Dihydroxyamino)-1-(2-Methylpropyl)-1-Nitrosoguanidine; 1-Isobutyl-2-Nitro-1-Nitroso-Guanidine |
| Molecular Structure | ![]() |
| Molecular Formula | C5H11N5O3 |
| Molecular Weight | 189.17 |
| CAS Registry Number | 5461-85-8 |
| SMILES | C(N(N=O)C(/N)=N/[N+]([O-])=O)C(C)C |
| InChI | 1S/C5H11N5O3/c1-4(2)3-9(8-11)5(6)7-10(12)13/h4H,3H2,1-2H3,(H2,6,7) |
| InChIKey | SSNMTYTXJCMMSO-UHFFFAOYSA-N |
| Density | 1.444g/cm3 (Cal.) |
|---|---|
| Boiling point | 300.452°C at 760 mmHg (Cal.) |
| Flash point | 135.509°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for N-Isobutyl-N'-nitro-N-nitrosoguanidine |