|
CAS#: 5462-96-4 Product: 8-Bromo-1,3-Dimethyl-7H-Purine-2,6-Dione, Cyclohexanamine No suppilers available for the product. |
| Name | 8-Bromo-1,3-Dimethyl-7H-Purine-2,6-Dione, Cyclohexanamine |
|---|---|
| Synonyms | 8-Bromo-1,3-Dimethyl-7H-Purine-2,6-Quinone; Cyclohexylamine; Nsc14352 |
| Molecular Structure | ![]() |
| Molecular Formula | C13H20BrN5O2 |
| Molecular Weight | 358.24 |
| CAS Registry Number | 5462-96-4 |
| SMILES | CN2C(N(C1=C([NH]C(=N1)Br)C2=O)C)=O.C3CCCCC3N |
| InChI | 1S/C7H7BrN4O2.C6H13N/c1-11-4-3(9-6(8)10-4)5(13)12(2)7(11)14;7-6-4-2-1-3-5-6/h1-2H3,(H,9,10);6H,1-5,7H2 |
| InChIKey | OOCUWLIPZGVYGI-UHFFFAOYSA-N |
| Boiling point | 469.5°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 237.7°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 8-Bromo-1,3-Dimethyl-7H-Purine-2,6-Dione, Cyclohexanamine |