|
CAS#: 54644-44-9 Product: 2,6-Diisopropylphenyl Pivalate No suppilers available for the product. |
| Name | 2,6-Diisopropylphenyl Pivalate |
|---|---|
| Synonyms | 2,6-Diisopropylphenyl pivalate # |
| Molecular Structure | ![]() |
| Molecular Formula | C17H26O2 |
| Molecular Weight | 262.39 |
| CAS Registry Number | 54644-44-9 |
| SMILES | O=C(Oc1c(cccc1C(C)C)C(C)C)C(C)(C)C |
| InChI | 1S/C17H26O2/c1-11(2)13-9-8-10-14(12(3)4)15(13)19-16(18)17(5,6)7/h8-12H,1-7H3 |
| InChIKey | WRUWATZSGKPVCK-UHFFFAOYSA-N |
| Density | 0.948g/cm3 (Cal.) |
|---|---|
| Boiling point | 301.336°C at 760 mmHg (Cal.) |
| Flash point | 108.281°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2,6-Diisopropylphenyl Pivalate |