Online Database of Chemicals from Around the World
| Alfa Chemistry | USA | Inquire | ||
|---|---|---|---|---|
 |
+1 (201) 478-8534 | |||
 |
inquiry@alfa-chemistry.com | |||
| Chemical distributor since 2012 | ||||
| chemBlink standard supplier since 2012 | ||||
| Name | Isopropyl 4-Methoxycinnamate |
|---|---|
| Synonyms | Propan-2-Yl 3-(4-Methoxyphenyl)Prop-2-Enoate; Isopropyl (E)-3-(4-Methoxyphenyl)Prop-2-Enoate; Isopropyl 3-(4-Methoxyphenyl)Prop-2-Enoate |
| Molecular Structure |  |
| Molecular Formula | C13H16O3 |
| Molecular Weight | 220.27 |
| CAS Registry Number | 5466-76-2 (53484-51-8) |
| EINECS | 226-774-1 |
| SMILES | C1=C(C=CC(=C1)OC)\C=C\C(OC(C)C)=O |
| InChI | 1S/C13H16O3/c1-10(2)16-13(14)9-6-11-4-7-12(15-3)8-5-11/h4-10H,1-3H3/b9-6+ |
| InChIKey | XATKDVHSLQMHSY-RMKNXTFCSA-N |
| Density | 1.06g/cm3 (Cal.) |
|---|---|
| Boiling point | 333.42°C at 760 mmHg (Cal.) |
| Flash point | 137.679°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Isopropyl 4-Methoxycinnamate |