|
CAS#: 5468-16-6 Product: 3-Carbamoyl-2-(4-Methoxyphenyl)Propanoic Acid No suppilers available for the product. |
| Name | 3-Carbamoyl-2-(4-Methoxyphenyl)Propanoic Acid |
|---|---|
| Synonyms | 4-Amino-2-(4-Methoxyphenyl)-4-Oxo-Butanoic Acid; 4-Amino-4-Keto-2-(4-Methoxyphenyl)Butyric Acid; Oprea1_702960 |
| Molecular Structure | ![]() |
| Molecular Formula | C11H13NO4 |
| Molecular Weight | 223.23 |
| CAS Registry Number | 5468-16-6 |
| SMILES | C1=CC(=CC=C1C(C(=O)O)CC(N)=O)OC |
| InChI | 1S/C11H13NO4/c1-16-8-4-2-7(3-5-8)9(11(14)15)6-10(12)13/h2-5,9H,6H2,1H3,(H2,12,13)(H,14,15) |
| InChIKey | DCRYCSHWUVYXNX-UHFFFAOYSA-N |
| Density | 1.272g/cm3 (Cal.) |
|---|---|
| Boiling point | 482.415°C at 760 mmHg (Cal.) |
| Flash point | 245.556°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 3-Carbamoyl-2-(4-Methoxyphenyl)Propanoic Acid |