|
CAS#: 5468-96-2 Product: (2,4-Dichlorophenyl)Methyl Acetate No suppilers available for the product. |
| Name | (2,4-Dichlorophenyl)Methyl Acetate |
|---|---|
| Synonyms | Acetic Acid (2,4-Dichlorophenyl)Methyl Ester; Acetic Acid (2,4-Dichlorobenzyl) Ester; (2,4-Dichlorophenyl)Methyl Ethanoate |
| Molecular Structure | ![]() |
| Molecular Formula | C9H8Cl2O2 |
| Molecular Weight | 219.07 |
| CAS Registry Number | 5468-96-2 |
| SMILES | C1=CC(=CC(=C1COC(=O)C)Cl)Cl |
| InChI | 1S/C9H8Cl2O2/c1-6(12)13-5-7-2-3-8(10)4-9(7)11/h2-4H,5H2,1H3 |
| InChIKey | TXJMBLACZHJNAE-UHFFFAOYSA-N |
| Density | 1.319g/cm3 (Cal.) |
|---|---|
| Boiling point | 269.205°C at 760 mmHg (Cal.) |
| Flash point | 109.714°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for (2,4-Dichlorophenyl)Methyl Acetate |