| International Laboratory Limited | USA | Inquire | ||
|---|---|---|---|---|
![]() |
+1 (650) 278-9963 | |||
![]() |
admin@intlab.org | |||
| Chemical manufacturer since 2002 | ||||
| SL Drugs and Pharmaceuticals Pvt. Ltd. | India | Inquire | ||
|---|---|---|---|---|
![]() |
+91 (40) 6661-1133 | |||
![]() |
enquiry@sldrugs.com | |||
| Chemical distributor since 1999 | ||||
| TimTec | USA | Inquire | ||
|---|---|---|---|---|
![]() |
+1 (302) 292-8500 | |||
![]() |
info@timtec.com | |||
| Chemical manufacturer | ||||
| Name | 1,2,5-Trihydroxypentane |
|---|---|
| Synonyms | [4-Acetoxy-1-(Acetoxymethyl)Butyl] Acetate; Acetic Acid [4-Acetoxy-1-(Acetoxymethyl)Butyl] Ester; 1,5-Diacetyloxypentan-2-Yl Ethanoate |
| Molecular Structure | ![]() |
| Molecular Formula | C11H18O6 |
| Molecular Weight | 246.26 |
| CAS Registry Number | 5470-86-0 |
| SMILES | C(OC(=O)C)CCC(OC(=O)C)COC(=O)C |
| InChI | 1S/C11H18O6/c1-8(12)15-6-4-5-11(17-10(3)14)7-16-9(2)13/h11H,4-7H2,1-3H3 |
| InChIKey | BRZLKIOVYHEWSE-UHFFFAOYSA-N |
| Density | 1.115g/cm3 (Cal.) |
|---|---|
| Boiling point | 314.472°C at 760 mmHg (Cal.) |
| Flash point | 134.736°C (Cal.) |
| SDS | Available |
|---|---|
| Market Analysis Reports |
| List of Reports Available for 1,2,5-Trihydroxypentane |