|
CAS#: 54725-02-9 Product: 2,3,5,8-Tetrahydroxy-6,7-Dimethoxy-1,4-Naphthoquinone No suppilers available for the product. |
| Name | 2,3,5,8-Tetrahydroxy-6,7-Dimethoxy-1,4-Naphthoquinone |
|---|---|
| Synonyms | 2,3,5,8-Tetrahydroxy-6,7-dimethoxynaphthoquinone # |
| Molecular Structure | ![]() |
| Molecular Formula | C12H10O8 |
| Molecular Weight | 282.20 |
| CAS Registry Number | 54725-02-9 |
| SMILES | Oc1c(OC)c(OC)c(O)c2C(=O)C(\O)=C(\O)C(=O)c12 |
| InChI | 1S/C12H10O8/c1-19-11-7(15)3-4(8(16)12(11)20-2)6(14)10(18)9(17)5(3)13/h15-18H,1-2H3 |
| InChIKey | SBJXOFGSLDAAEL-UHFFFAOYSA-N |
| Density | 1.793g/cm3 (Cal.) |
|---|---|
| Boiling point | 627.706°C at 760 mmHg (Cal.) |
| Flash point | 247°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2,3,5,8-Tetrahydroxy-6,7-Dimethoxy-1,4-Naphthoquinone |