|
CAS#: 54762-86-6 Product: Endo-1-(4-Bicyclo[2.2.1]Hept-2-Ylphenyl)Ethan-1-One No suppilers available for the product. |
| Name | Endo-1-(4-Bicyclo[2.2.1]Hept-2-Ylphenyl)Ethan-1-One |
|---|---|
| Synonyms | 1-(4-Norbornan-2-Ylphenyl)Ethanone; 1-[4-(2-Norbornanyl)Phenyl]Ethanone; 1-[4-(2-Norbornyl)Phenyl]Ethanone |
| Molecular Structure | ![]() |
| Molecular Formula | C15H18O |
| Molecular Weight | 214.31 |
| CAS Registry Number | 54762-86-6 |
| EINECS | 259-326-9 |
| SMILES | C1=CC(=CC=C1C3C2CC(CC2)C3)C(=O)C |
| InChI | 1S/C15H18O/c1-10(16)12-4-6-13(7-5-12)15-9-11-2-3-14(15)8-11/h4-7,11,14-15H,2-3,8-9H2,1H3 |
| InChIKey | RIQCUGGXKQATJX-UHFFFAOYSA-N |
| Density | 1.067g/cm3 (Cal.) |
|---|---|
| Boiling point | 342.842°C at 760 mmHg (Cal.) |
| Flash point | 147.454°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Endo-1-(4-Bicyclo[2.2.1]Hept-2-Ylphenyl)Ethan-1-One |