|
CAS#: 54783-68-5 Product: 5,5-Dimethyl-beta-Carotene No suppilers available for the product. |
| Name | 5,5-Dimethyl-beta-Carotene |
|---|---|
| Synonyms | 5,5-Dimethyl-Beta-Carotene; Dimethyl-Beta-Carotene; Beta,Beta-Carotene, 2,2'-Dimethyl-, (2R,2'R)- |
| Molecular Structure | ![]() |
| Molecular Formula | C42H60 |
| Molecular Weight | 564.94 |
| CAS Registry Number | 54783-68-5 |
| SMILES | CC1(C(=C(CCC1C)C)\C=C\C(=C\C=C\C(=C\C=C\C=C(\C=C\C=C(\C=C\C2=C(CCC(C2(C)C)C)C)C)C)C)C)C |
| InChI | 1S/C42H60/c1-31(19-15-21-33(3)23-29-39-35(5)25-27-37(7)41(39,9)10)17-13-14-18-32(2)20-16-22-34(4)24-30-40-36(6)26-28-38(8)42(40,11)12/h13-24,29-30,37-38H,25-28H2,1-12H3/b14-13+,19-15+,20-16+,29-23+,30-24+,31-17+,32-18+,33-21+,34-22+ |
| InChIKey | UUGAAKPXTFIHGP-XLBBLVADSA-N |
| Density | 0.926g/cm3 (Cal.) |
|---|---|
| Boiling point | 666.656°C at 760 mmHg (Cal.) |
| Flash point | 355.509°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 5,5-Dimethyl-beta-Carotene |