|
CAS#: 54832-83-6 Product: trans-Octahydro-2,2,4,4,7,7-hexamethyl-1H-Indene No suppilers available for the product. |
| Name | trans-Octahydro-2,2,4,4,7,7-hexamethyl-1H-Indene |
|---|---|
| Synonyms | 1H-Indene, Octahydro-2,2,4,4,7,7-Hexamethyl-, Trans-; 2,2,4,4,7,7-Hexamethyloctahydro-1H-Indene; Octahydro-2,2,4,4,7,7-Hexamethyl-1H-Indene (Tr*) |
| Molecular Structure | ![]() |
| Molecular Formula | C15H28 |
| Molecular Weight | 208.39 |
| CAS Registry Number | 54832-83-6 |
| SMILES | CC2(CC1C(CCC(C1C2)(C)C)(C)C)C |
| InChI | 1S/C15H28/c1-13(2)9-11-12(10-13)15(5,6)8-7-14(11,3)4/h11-12H,7-10H2,1-6H3 |
| InChIKey | RKCBUJRCTQZATH-UHFFFAOYSA-N |
| Density | 0.814g/cm3 (Cal.) |
|---|---|
| Boiling point | 239.416°C at 760 mmHg (Cal.) |
| Flash point | 93.996°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for trans-Octahydro-2,2,4,4,7,7-hexamethyl-1H-Indene |